* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10700531 |
| English Synonyms: | SELENA SEL10700531 |
| MDL Number.: | MFCD17097756 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1F)SCCNCCc2ccsc2 |
| InChi: | InChI=1S/C14H16FNS2/c15-13-1-3-14(4-2-13)18-10-8-16-7-5-12-6-9-17-11-12/h1-4,6,9,11,16H,5,7-8,10H2 |
| InChiKey: | InChIKey=HKQCPZIVZXGZEP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.