* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10701043 |
English Synonyms: | SELENA SEL10701043 |
MDL Number.: | MFCD17098267 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1cc(cn1)SCCNCCc2ccsc2 |
InChi: | InChI=1S/C12H17N3S2/c1-15-9-12(8-14-15)17-7-5-13-4-2-11-3-6-16-10-11/h3,6,8-10,13H,2,4-5,7H2,1H3 |
InChiKey: | InChIKey=AUZXAZATGZPAST-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.