Molecular Structure:
CCD No.:CCD03366158
SELENA SEL10701067
Formula:C10 H5 Cl F3 N3 O
MolWeight:275.616
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10701067 |
| English Synonyms： | SELENA SEL10701067 |
| MDL Number.： | MFCD17098291 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1ccc(c(c1)n2cc(nn2)C(=O)C(F)(F)F)Cl |
| InChi： | InChI=1S/C10H5ClF3N3O/c11-6-3-1-2-4-8(6)17-5-7(15-16-17)9(18)10(12,13)14/h1-5H |
| InChiKey： | InChIKey=XGKUNOGAXHXMRS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
