Molecular Structure:
CCD No.:CCD03366167
SELENA SEL10701077
Formula:C10 H4 Cl2 F3 N3 O
MolWeight:310.062
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10701077 |
| English Synonyms： | SELENA SEL10701077 |
| MDL Number.： | MFCD17098300 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1cc(c(cc1n2cc(nn2)C(=O)C(F)(F)F)Cl)Cl |
| InChi： | InChI=1S/C10H4Cl2F3N3O/c11-6-2-1-5(3-7(6)12)18-4-8(16-17-18)9(19)10(13,14)15/h1-4H |
| InChiKey： | InChIKey=NUSWSWLQEPKMAP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
