Molecular Structure:
CCD No.:CCD03366176
SELENA SEL10701086
Formula:C8 H8 F3 N5 O3
MolWeight:279.177
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10701086 |
| English Synonyms： | SELENA SEL10701086 |
| MDL Number.： | MFCD17098309 |
| H bond acceptor： | 8 |
| H bond donor： | 2 |
| Smile： | CC(=O)NNC(=O)Cn1cc(nn1)C(=O)C(F)(F)F |
| InChi： | InChI=1S/C8H8F3N5O3/c1-4(17)12-14-6(18)3-16-2-5(13-15-16)7(19)8(9,10)11/h2H,3H2,1H3,(H,12,17)(H,14,18) |
| InChiKey： | InChIKey=GNSHRYTYPCCEBR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
