Molecular Structure:
CCD No.:CCD03366180
SELENA SEL10701090
Formula:C9 H11 F3 N4 O2
MolWeight:264.206
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10701090 |
| English Synonyms： | SELENA SEL10701090 |
| MDL Number.： | MFCD17098313 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | CN(C)C(=O)CCn1cc(nn1)C(=O)C(F)(F)F |
| InChi： | InChI=1S/C9H11F3N4O2/c1-15(2)7(17)3-4-16-5-6(13-14-16)8(18)9(10,11)12/h5H,3-4H2,1-2H3 |
| InChiKey： | InChIKey=GAXSRPZINIUGQH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
