* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10703797 |
| English Synonyms: | SELENA SEL10703797 |
| MDL Number.: | MFCD17099444 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCNCc1ccoc1CN2CCS(=O)(=O)CC2 |
| InChi: | InChI=1S/C12H20N2O3S/c1-2-13-9-11-3-6-17-12(11)10-14-4-7-18(15,16)8-5-14/h3,6,13H,2,4-5,7-10H2,1H3 |
| InChiKey: | InChIKey=WTRRFFPIWJEJJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.