* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC939432 |
English Synonyms: | BCH-RESEARCH BC939432 |
MDL Number.: | MFCD17099449 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCc1ccoc1CN2CCS(=O)CC2 |
InChi: | InChI=1S/C12H20N2O2S/c1-2-13-9-11-3-6-16-12(11)10-14-4-7-17(15)8-5-14/h3,6,13H,2,4-5,7-10H2,1H3 |
InChiKey: | InChIKey=WGOBWHMMJGPYJA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.