* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL[1-(OXAN-4-YL)-3-(PYRIDIN-3-YL)PROPAN-2-YL]AMINE |
| English Synonyms: | ETHYL[1-(OXAN-4-YL)-3-(PYRIDIN-3-YL)PROPAN-2-YL]AMINE |
| MDL Number.: | MFCD17102096 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCNC(Cc1cccnc1)CC2CCOCC2 |
| InChi: | InChI=1S/C15H24N2O/c1-2-17-15(10-13-5-8-18-9-6-13)11-14-4-3-7-16-12-14/h3-4,7,12-13,15,17H,2,5-6,8-11H2,1H3 |
| InChiKey: | InChIKey=BCYMVSANDQIJFM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.