Molecular Structure:
CCD No.:CCD03369646
SELENA SEL10706717
Formula:C14 H28 N2 O2 S
MolWeight:288.453
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10706717 |
| English Synonyms： | SELENA SEL10706717 |
| MDL Number.： | MFCD17102325 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCCNC1CCCCC1CN2CCS(=O)(=O)CC2 |
| InChi： | InChI=1S/C14H28N2O2S/c1-2-7-15-14-6-4-3-5-13(14)12-16-8-10-19(17,18)11-9-16/h13-15H,2-12H2,1H3 |
| InChiKey： | InChIKey=LTJOWVPOSJURIK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
