* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10709481 |
| English Synonyms: | SELENA SEL10709481 |
| MDL Number.: | MFCD17105064 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C(=O)O)N(C)C(=O)c1cc(cn1C)S(=O)(=O)N |
| InChi: | InChI=1S/C10H15N3O5S/c1-6(10(15)16)13(3)9(14)8-4-7(5-12(8)2)19(11,17)18/h4-6H,1-3H3,(H,15,16)(H2,11,17,18) |
| InChiKey: | InChIKey=ZRGNFIILCPTCQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.