Molecular Structure:
CCD No.:CCD03372268
SELENA SEL10709484
Formula:C14 H16 Br N O3
MolWeight:326.188
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10709484 |
| English Synonyms： | SELENA SEL10709484 |
| MDL Number.： | MFCD17105067 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(c(c1)Br)/C=C/C(=O)N(C)C(C)C(=O)O |
| InChi： | InChI=1S/C14H16BrNO3/c1-9-4-5-11(12(15)8-9)6-7-13(17)16(3)10(2)14(18)19/h4-8,10H,1-3H3,(H,18,19)/b7-6+ |
| InChiKey： | InChIKey=OJQQQAREEQROEO-VOTSOKGWSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
