Molecular Structure:
CCD No.:CCD03372280
SELENA SEL10709496
Formula:C12 H16 N2 O4 S
MolWeight:284.334
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10709496 |
| English Synonyms： | SELENA SEL10709496 |
| MDL Number.： | MFCD17105079 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CC(C(=O)O)N(C)C(=O)CCNC(=O)c1ccsc1 |
| InChi： | InChI=1S/C12H16N2O4S/c1-8(12(17)18)14(2)10(15)3-5-13-11(16)9-4-6-19-7-9/h4,6-8H,3,5H2,1-2H3,(H,13,16)(H,17,18) |
| InChiKey： | InChIKey=VDOGALODVHIOIV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
