Molecular Structure:
CCD No.:CCD03372283
SELENA SEL10709499
Formula:C13 H17 N O4
MolWeight:251.28
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10709499 |
| English Synonyms： | SELENA SEL10709499 |
| MDL Number.： | MFCD17105082 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(c(c1)C(=O)N(C)C(C)C(=O)O)OC |
| InChi： | InChI=1S/C13H17NO4/c1-8-5-6-11(18-4)10(7-8)12(15)14(3)9(2)13(16)17/h5-7,9H,1-4H3,(H,16,17) |
| InChiKey： | InChIKey=AAAYDTYXDOKBDR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
