Molecular Structure:
CCD No.:CCD03373117
SELENA SEL10710350
Formula:C15 H26 N2 O
MolWeight:250.383
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10710350 |
| English Synonyms： | SELENA SEL10710350 |
| MDL Number.： | MFCD17105927 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCC(c1ccco1)NCC2CCN(C2)C(C)C |
| InChi： | InChI=1S/C15H26N2O/c1-4-14(15-6-5-9-18-15)16-10-13-7-8-17(11-13)12(2)3/h5-6,9,12-14,16H,4,7-8,10-11H2,1-3H3 |
| InChiKey： | InChIKey=YTBRYVAQFBGCHX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
