Molecular Structure:
CCD No.:CCD03373123
SELENA SEL10710356
Formula:C14 H24 N2 O
MolWeight:236.357
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10710356 |
| English Synonyms： | SELENA SEL10710356 |
| MDL Number.： | MFCD17105933 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCC(c1ccco1)NCCN2CCCCC2 |
| InChi： | InChI=1S/C14H24N2O/c1-2-13(14-7-6-12-17-14)15-8-11-16-9-4-3-5-10-16/h6-7,12-13,15H,2-5,8-11H2,1H3 |
| InChiKey： | InChIKey=HACBQKIZTQQJAA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
