Molecular Structure:
CCD No.:CCD03373390
SELENA SEL10710627
Formula:C12 H26 N4 O2
MolWeight:258.363
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10710627 |
| English Synonyms： | SELENA SEL10710627 |
| MDL Number.： | MFCD17106204 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | CC(C)C(/C(=N/O)/N)C(=O)NCCN(C)C(C)C |
| InChi： | InChI=1S/C12H26N4O2/c1-8(2)10(11(13)15-18)12(17)14-6-7-16(5)9(3)4/h8-10,18H,6-7H2,1-5H3,(H2,13,15)(H,14,17) |
| InChiKey： | InChIKey=YMEBFRSXWQFDRT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
