Molecular Structure:
CCD No.:CCD03374345
SELENA SEL10711645
Formula:C13 H19 N3 O3
MolWeight:265.311
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10711645 |
| English Synonyms： | SELENA SEL10711645 |
| MDL Number.： | MFCD17107196 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | CCOc1ccccc1C(=O)NCC(C)/C(=N/O)/N |
| InChi： | InChI=1S/C13H19N3O3/c1-3-19-11-7-5-4-6-10(11)13(17)15-8-9(2)12(14)16-18/h4-7,9,18H,3,8H2,1-2H3,(H2,14,16)(H,15,17) |
| InChiKey： | InChIKey=NQSLFGLCKGUNMA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
