Molecular Structure:
CCD No.:CCD03374366
SELENA SEL10711666
Formula:C9 H10 Br Cl2 N3 O3 S
MolWeight:391.072
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10711666 |
| English Synonyms： | SELENA SEL10711666 |
| MDL Number.： | MFCD17107217 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | c1c(cc(c(c1Cl)S(=O)(=O)NCC/C(=N\O)/N)Cl)Br |
| InChi： | InChI=1S/C9H10BrCl2N3O3S/c10-5-3-6(11)9(7(12)4-5)19(17,18)14-2-1-8(13)15-16/h3-4,14,16H,1-2H2,(H2,13,15) |
| InChiKey： | InChIKey=RPFFUCKHAHKUAQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
