Molecular Structure:
CCD No.:CCD03374699
SELENA SEL10712016
Formula:C11 H18 N4 O S
MolWeight:254.356
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10712016 |
| English Synonyms： | SELENA SEL10712016 |
| MDL Number.： | MFCD17107551 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCC(CC(=S)N)NC(=O)c1cnn(c1C)C |
| InChi： | InChI=1S/C11H18N4OS/c1-4-8(5-10(12)17)14-11(16)9-6-13-15(3)7(9)2/h6,8H,4-5H2,1-3H3,(H2,12,17)(H,14,16) |
| InChiKey： | InChIKey=NHXXVQYUTWPYJQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
