Molecular Structure:
CCD No.:CCD03376451
SELENA SEL10713815
Formula:C14 H19 Cl N2 O
MolWeight:266.77
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10713815 |
| English Synonyms： | SELENA SEL10713815 |
| MDL Number.： | MFCD17109338 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CCCNCCNC(=O)/C=C/c1ccc(cc1)Cl |
| InChi： | InChI=1S/C14H19ClN2O/c1-2-9-16-10-11-17-14(18)8-5-12-3-6-13(15)7-4-12/h3-8,16H,2,9-11H2,1H3,(H,17,18)/b8-5+ |
| InChiKey： | InChIKey=BGHWIACWZKXJSV-VMPITWQZSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
