Molecular Structure:
CCD No.:CCD03376551
SELENA SEL10713917
Formula:C14 H17 Cl N2 O
MolWeight:264.754
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10713917 |
| English Synonyms： | SELENA SEL10713917 |
| MDL Number.： | MFCD17109438 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | c1cc(ccc1/C=C/C(=O)NCCNC2CC2)Cl |
| InChi： | InChI=1S/C14H17ClN2O/c15-12-4-1-11(2-5-12)3-8-14(18)17-10-9-16-13-6-7-13/h1-5,8,13,16H,6-7,9-10H2,(H,17,18)/b8-3+ |
| InChiKey： | InChIKey=GLICTRYOFCUVBP-FPYGCLRLSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
