Molecular Structure:
CCD No.:CCD03376656
SELENA SEL10714023
Formula:C10 H22 N2 O4 S2
MolWeight:298.426
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10714023 |
| English Synonyms： | SELENA SEL10714023 |
| MDL Number.： | MFCD17109543 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CC(C)NCCNS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChi： | InChI=1S/C10H22N2O4S2/c1-9(2)11-5-6-12-18(15,16)10-3-7-17(13,14)8-4-10/h9-12H,3-8H2,1-2H3 |
| InChiKey： | InChIKey=LYQSRRZVNVZGLR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
