* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10714959 |
| English Synonyms: | SELENA SEL10714959 |
| MDL Number.: | MFCD17110463 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CC(CNC(=O)[C@H](Cc1ccc(cc1)O)N)C(=O)O |
| InChi: | InChI=1S/C13H18N2O4/c1-8(13(18)19)7-15-12(17)11(14)6-9-2-4-10(16)5-3-9/h2-5,8,11,16H,6-7,14H2,1H3,(H,15,17)(H,18,19)/t8?,11-/m0/s1 |
| InChiKey: | InChIKey=CAVFESATBCYIBT-LYNSQETBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.