* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10714960 |
English Synonyms: | SELENA SEL10714960 |
MDL Number.: | MFCD17110464 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(CNC(=O)[C@@H]1Cc2ccccc2N1)C(=O)O |
InChi: | InChI=1S/C13H16N2O3/c1-8(13(17)18)7-14-12(16)11-6-9-4-2-3-5-10(9)15-11/h2-5,8,11,15H,6-7H2,1H3,(H,14,16)(H,17,18)/t8?,11-/m0/s1 |
InChiKey: | InChIKey=XCSLWKAUVBGSMC-LYNSQETBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.