Molecular Structure:
CCD No.:CCD03378568
SELENA SEL10716046
Formula:C9 H13 N5 O2 S
MolWeight:255.301
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10716046 |
| English Synonyms： | SELENA SEL10716046 |
| MDL Number.： | MFCD17111521 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | c1cnc(c(n1)/C(=N\O)/N)N2CCS(=O)CC2 |
| InChi： | InChI=1S/C9H13N5O2S/c10-8(13-15)7-9(12-2-1-11-7)14-3-5-17(16)6-4-14/h1-2,15H,3-6H2,(H2,10,13) |
| InChiKey： | InChIKey=AMGGYSNKCIZTSO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
