Molecular Structure:
CCD No.:CCD03378575
SELENA SEL10716053
Formula:C12 H17 N5 O2
MolWeight:263.299
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10716053 |
| English Synonyms： | SELENA SEL10716053 |
| MDL Number.： | MFCD17111528 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | c1cnc(c(n1)/C(=N\O)/N)N2CCOC3C2CCC3 |
| InChi： | InChI=1S/C12H17N5O2/c13-11(16-18)10-12(15-5-4-14-10)17-6-7-19-9-3-1-2-8(9)17/h4-5,8-9,18H,1-3,6-7H2,(H2,13,16) |
| InChiKey： | InChIKey=BEUVVQARMGTNQI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
