* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10716290 |
English Synonyms: | SELENA SEL10716290 |
MDL Number.: | MFCD17111763 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C=CCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O |
InChi: | InChI=1S/C14H17NO4/c1-2-3-4-13(17)15-12(14(18)19)9-10-5-7-11(16)8-6-10/h2,5-8,12,16H,1,3-4,9H2,(H,15,17)(H,18,19)/t12-/m0/s1 |
InChiKey: | InChIKey=OIXIJOATZZCVJG-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.