Molecular Structure:
CCD No.:CCD03378810
SELENA SEL10716292
Formula:C13 H13 N O3
MolWeight:231.25
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10716292 |
| English Synonyms： | SELENA SEL10716292 |
| MDL Number.： | MFCD17111765 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | C=CCC(=O)N1c2ccccc2C[C@H]1C(=O)O |
| InChi： | InChI=1S/C13H13NO3/c1-2-5-12(15)14-10-7-4-3-6-9(10)8-11(14)13(16)17/h2-4,6-7,11H,1,5,8H2,(H,16,17)/t11-/m0/s1 |
| InChiKey： | InChIKey=MVORDWFOOXZZMO-NSHDSACASA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
