Molecular Structure:
CCD No.:CCD03379054
SELENA SEL10716542
Formula:C10 H18 N4 O2 S
MolWeight:258.344
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10716542 |
| English Synonyms： | SELENA SEL10716542 |
| MDL Number.： | MFCD17112009 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CCCc1nc(n(n1)C2(CCS(=O)(=O)C2)C)N |
| InChi： | InChI=1S/C10H18N4O2S/c1-3-4-8-12-9(11)14(13-8)10(2)5-6-17(15,16)7-10/h3-7H2,1-2H3,(H2,11,12,13) |
| InChiKey： | InChIKey=PHSWZHIUBDPZFA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
