Molecular Structure:
CCD No.:CCD03379572
SELENA SEL10717075
Formula:C10 H17 N5 O4
MolWeight:271.275
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717075 |
| English Synonyms： | SELENA SEL10717075 |
| MDL Number.： | MFCD17112536 |
| H bond acceptor： | 9 |
| H bond donor： | 1 |
| Smile： | CN(C)C(=O)CN(CCOC)C(=O)c1c(non1)N |
| InChi： | InChI=1S/C10H17N5O4/c1-14(2)7(16)6-15(4-5-18-3)10(17)8-9(11)13-19-12-8/h4-6H2,1-3H3,(H2,11,13) |
| InChiKey： | InChIKey=BPAAJXOUXYJRQP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
