Molecular Structure:
CCD No.:CCD03379574
SELENA SEL11586987
Formula:C10 H15 N5 O2
MolWeight:237.262
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL11586987 |
| English Synonyms： | SELENA SEL11586987 |
| MDL Number.： | MFCD17112538 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | C1CC2CN(CCN2C1)C(=O)c3c(non3)N |
| InChi： | InChI=1S/C10H15N5O2/c11-9-8(12-17-13-9)10(16)15-5-4-14-3-1-2-7(14)6-15/h7H,1-6H2,(H2,11,13) |
| InChiKey： | InChIKey=WUWXZCCDNBRMBC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
