* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10717080 |
| English Synonyms: | SELENA SEL10717080 |
| MDL Number.: | MFCD17112541 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CN(CC(=O)NCC(F)(F)F)C(=O)c1c(non1)N |
| InChi: | InChI=1S/C8H10F3N5O3/c1-16(2-4(17)13-3-8(9,10)11)7(18)5-6(12)15-19-14-5/h2-3H2,1H3,(H2,12,15)(H,13,17) |
| InChiKey: | InChIKey=GZTZYXKCHREFMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.