Molecular Structure:
CCD No.:CCD03379581
SELENA SEL10717084
Formula:C11 H18 N4 O4
MolWeight:270.287
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717084 |
| English Synonyms： | SELENA SEL10717084 |
| MDL Number.： | MFCD17112545 |
| H bond acceptor： | 8 |
| H bond donor： | 1 |
| Smile： | CC(C)CN(CCC(=O)OC)C(=O)c1c(non1)N |
| InChi： | InChI=1S/C11H18N4O4/c1-7(2)6-15(5-4-8(16)18-3)11(17)9-10(12)14-19-13-9/h7H,4-6H2,1-3H3,(H2,12,14) |
| InChiKey： | InChIKey=AJNUNQWRNCYGEN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
