* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10717093 |
English Synonyms: | SELENA SEL10717093 |
MDL Number.: | MFCD17112554 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CN(CC(=O)NCCCOC)C(=O)c1c(non1)N |
InChi: | InChI=1S/C10H17N5O4/c1-15(6-7(16)12-4-3-5-18-2)10(17)8-9(11)14-19-13-8/h3-6H2,1-2H3,(H2,11,14)(H,12,16) |
InChiKey: | InChIKey=BJPQNCOYDMTSHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.