* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10717095 |
English Synonyms: | SELENA SEL10717095 |
MDL Number.: | MFCD17112556 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CCOC(=O)CN(C1CC1)C(=O)c2c(non2)N |
InChi: | InChI=1S/C10H14N4O4/c1-2-17-7(15)5-14(6-3-4-6)10(16)8-9(11)13-18-12-8/h6H,2-5H2,1H3,(H2,11,13) |
InChiKey: | InChIKey=VDYKXADRPWSKSY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.