* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10717099 |
English Synonyms: | SELENA SEL10717099 |
MDL Number.: | MFCD17112560 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CCC(C)NC(=O)CCNC(=O)c1c(non1)N |
InChi: | InChI=1S/C10H17N5O3/c1-3-6(2)13-7(16)4-5-12-10(17)8-9(11)15-18-14-8/h6H,3-5H2,1-2H3,(H2,11,15)(H,12,17)(H,13,16) |
InChiKey: | InChIKey=LDKABKNGQKRKPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.