* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10717106 |
| English Synonyms: | SELENA SEL10717106 |
| MDL Number.: | MFCD17112567 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | c1cc(cc(c1)NC(=O)c2c(non2)N)C(=O)O |
| InChi: | InChI=1S/C10H8N4O4/c11-8-7(13-18-14-8)9(15)12-6-3-1-2-5(4-6)10(16)17/h1-4H,(H2,11,14)(H,12,15)(H,16,17) |
| InChiKey: | InChIKey=JUBHJXVBCSQTMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.