Molecular Structure:
CCD No.:CCD03379608
SELENA SEL10717111
Formula:C8 H11 N5 O5
MolWeight:257.205
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717111 |
| English Synonyms： | SELENA SEL10717111 |
| MDL Number.： | MFCD17112572 |
| H bond acceptor： | 10 |
| H bond donor： | 4 |
| Smile： | C(CC(=O)N)C(C(=O)O)NC(=O)c1c(non1)N |
| InChi： | InChI=1S/C8H11N5O5/c9-4(14)2-1-3(8(16)17)11-7(15)5-6(10)13-18-12-5/h3H,1-2H2,(H2,9,14)(H2,10,13)(H,11,15)(H,16,17) |
| InChiKey： | InChIKey=JCPWYIRJGMTRCF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
