Molecular Structure:
CCD No.:CCD03379609
SELENA SEL10717112
Formula:C10 H16 N4 O4
MolWeight:256.26
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717112 |
| English Synonyms： | SELENA SEL10717112 |
| MDL Number.： | MFCD17112573 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | C(CCCNC(=O)c1c(non1)N)CCC(=O)O |
| InChi： | InChI=1S/C10H16N4O4/c11-9-8(13-18-14-9)10(17)12-6-4-2-1-3-5-7(15)16/h1-6H2,(H2,11,14)(H,12,17)(H,15,16) |
| InChiKey： | InChIKey=JTAGFFKZQQDMJP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
