Molecular Structure:
CCD No.:CCD03379610
SELENA SEL10717113
Formula:C9 H12 N4 O4
MolWeight:240.218
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717113 |
| English Synonyms： | SELENA SEL10717113 |
| MDL Number.： | MFCD17112574 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | C1CCC(C1)(C(=O)O)NC(=O)c2c(non2)N |
| InChi： | InChI=1S/C9H12N4O4/c10-6-5(12-17-13-6)7(14)11-9(8(15)16)3-1-2-4-9/h1-4H2,(H2,10,13)(H,11,14)(H,15,16) |
| InChiKey： | InChIKey=WWMLMJMIGSRLOZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
