Molecular Structure:
CCD No.:CCD03379613
SELENA SEL10717116
Formula:C9 H12 N4 O4
MolWeight:240.218
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717116 |
| English Synonyms： | SELENA SEL10717116 |
| MDL Number.： | MFCD17112577 |
| H bond acceptor： | 8 |
| H bond donor： | 2 |
| Smile： | C1CC1N(CCC(=O)O)C(=O)c2c(non2)N |
| InChi： | InChI=1S/C9H12N4O4/c10-8-7(11-17-12-8)9(16)13(5-1-2-5)4-3-6(14)15/h5H,1-4H2,(H2,10,12)(H,14,15) |
| InChiKey： | InChIKey=PDLMXYLMTYMXHH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
