Molecular Structure:
CCD No.:CCD03379617
SELENA SEL10717120
Formula:C8 H12 N4 O4 S
MolWeight:260.273
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717120 |
| English Synonyms： | SELENA SEL10717120 |
| MDL Number.： | MFCD17112581 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | CSCC[C@@H](C(=O)O)NC(=O)c1c(non1)N |
| InChi： | InChI=1S/C8H12N4O4S/c1-17-3-2-4(8(14)15)10-7(13)5-6(9)12-16-11-5/h4H,2-3H2,1H3,(H2,9,12)(H,10,13)(H,14,15)/t4-/m0/s1 |
| InChiKey： | InChIKey=WHORSGUYSITQOS-BYPYZUCNSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
