* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10717121 |
| English Synonyms: | SELENA SEL10717121 |
| MDL Number.: | MFCD17112582 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CCC(C)[C@@H](C(=O)O)NC(=O)c1c(non1)N |
| InChi: | InChI=1S/C9H14N4O4/c1-3-4(2)5(9(15)16)11-8(14)6-7(10)13-17-12-6/h4-5H,3H2,1-2H3,(H2,10,13)(H,11,14)(H,15,16)/t4?,5-/m0/s1 |
| InChiKey: | InChIKey=UCAOTCVVAWEVBI-AKGZTFGVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.