Molecular Structure:
CCD No.:CCD03379634
SELENA SEL10717137
Formula:C10 H8 N4 O5
MolWeight:264.196
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717137 |
| English Synonyms： | SELENA SEL10717137 |
| MDL Number.： | MFCD17112598 |
| H bond acceptor： | 9 |
| H bond donor： | 4 |
| Smile： | c1cc(c(cc1O)C(=O)O)NC(=O)c2c(non2)N |
| InChi： | InChI=1S/C10H8N4O5/c11-8-7(13-19-14-8)9(16)12-6-2-1-4(15)3-5(6)10(17)18/h1-3,15H,(H2,11,14)(H,12,16)(H,17,18) |
| InChiKey： | InChIKey=LOVWRTYJZVUOKE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
