Molecular Structure:
CCD No.:CCD03379838
SELENA SEL10717347
Formula:C13 H14 N2 O2
MolWeight:230.266
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717347 |
| English Synonyms： | SELENA SEL10717347 |
| MDL Number.： | MFCD17112805 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | Cn1cc(cn1)CC(=O)COc2ccccc2 |
| InChi： | InChI=1S/C13H14N2O2/c1-15-9-11(8-14-15)7-12(16)10-17-13-5-3-2-4-6-13/h2-6,8-9H,7,10H2,1H3 |
| InChiKey： | InChIKey=OJSWCPILSPPBPW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
