* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC970223 |
| English Synonyms: | BCH-RESEARCH BC970223 |
| MDL Number.: | MFCD17113013 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCNC(CCOc1ccccc1)c2ccco2 |
| InChi: | InChI=1S/C15H19NO2/c1-2-16-14(15-9-6-11-18-15)10-12-17-13-7-4-3-5-8-13/h3-9,11,14,16H,2,10,12H2,1H3 |
| InChiKey: | InChIKey=OHSVFDBRRPDAJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.