* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10717641 |
| English Synonyms: | SELENA SEL10717641 |
| MDL Number.: | MFCD17113086 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | c1cc(ccc1/C(=N\O)/N)NC(=O)NC2CC2 |
| InChi: | InChI=1S/C11H14N4O2/c12-10(15-17)7-1-3-8(4-2-7)13-11(16)14-9-5-6-9/h1-4,9,17H,5-6H2,(H2,12,15)(H2,13,14,16) |
| InChiKey: | InChIKey=WLKHQKGRVBPTLR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.