Molecular Structure:
CCD No.:CCD03380105
SELENA SEL10717646
Formula:C12 H16 N4 O2
MolWeight:248.284
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10717646 |
| English Synonyms： | SELENA SEL10717646 |
| MDL Number.： | MFCD17113091 |
| H bond acceptor： | 6 |
| H bond donor： | 4 |
| Smile： | c1cc(ccc1CNC(=O)NC2CC2)/C(=N\O)/N |
| InChi： | InChI=1S/C12H16N4O2/c13-11(16-18)9-3-1-8(2-4-9)7-14-12(17)15-10-5-6-10/h1-4,10,18H,5-7H2,(H2,13,16)(H2,14,15,17) |
| InChiKey： | InChIKey=QNMRICYMWYSYFU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
