* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10718216 |
English Synonyms: | SELENA SEL10718216 |
MDL Number.: | MFCD17113658 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCN(CC(=O)N(C)C)C1CS(=O)(=O)CC1N |
InChi: | InChI=1S/C10H21N3O3S/c1-4-13(5-10(14)12(2)3)9-7-17(15,16)6-8(9)11/h8-9H,4-7,11H2,1-3H3 |
InChiKey: | InChIKey=FZTYMQVOSBDYHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.